C23H24Cl2FN3O3S2 — CID 135160447
ethyl 2-[3-[5-chloro-2-[2-chloro-5-fluoro-4-(1,3-thiazol-2-ylamino)sulfanylphenoxy]phenyl]propyl-methylamino]acetate (PubChem CID 135160447) has the molecular formula C23H24Cl2FN3O3S2 and a molecular weight of 544.50 g/mol. Its IUPAC name is ethyl 2-[3-[5-chloro-2-[2-chloro-5-fluoro-4-(1,3-thiazol-2-ylamino)sulfanylphenoxy]phenyl]propyl-methylamino]acetate.
| Compound Name | ethyl 2-[3-[5-chloro-2-[2-chloro-5-fluoro-4-(1,3-thiazol-2-ylamino)sulfanylphenoxy]phenyl]propyl-methylamino]acetate |
|---|---|
| PubChem CID | 135160447 |
| Molecular Formula | C23H24Cl2FN3O3S2 |
| Molecular Weight | 544.50 g/mol |
| Exact Mass | 543.06 |
| IUPAC Name | ethyl 2-[3-[5-chloro-2-[2-chloro-5-fluoro-4-(1,3-thiazol-2-ylamino)sulfanylphenoxy]phenyl]propyl-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)CCCc1cc(Cl)ccc1Oc1cc(F)c(SNc2nccs2)cc1Cl |
| InChI | InChI=1S/C23H24Cl2FN3O3S2/c1-3-31-22(30)14-29(2)9-4-5-15-11-16(24)6-7-19(15)32-20-13-18(26)21(12-17(20)25)34-28-23-27-8-10-33-23/h6-8,10-13H,3-5,9,14H2,1-2H3,(H,27,28) |
| InChIKey | JGWJHIATUDVQEA-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.50 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|