C23H24Cl2FN3O4S2 — CID 145039297
ethyl 2-[3-[5-chloro-2-[2-chloro-5-fluoro-4-[methyl(1,3-thiazol-2-yl)sulfinamoyl]phenoxy]phenyl]propylamino]acetate (PubChem CID 145039297) has the molecular formula C23H24Cl2FN3O4S2 and a molecular weight of 560.50 g/mol. Its IUPAC name is ethyl 2-[3-[5-chloro-2-[2-chloro-5-fluoro-4-[methyl(1,3-thiazol-2-yl)sulfinamoyl]phenoxy]phenyl]propylamino]acetate.
| Compound Name | ethyl 2-[3-[5-chloro-2-[2-chloro-5-fluoro-4-[methyl(1,3-thiazol-2-yl)sulfinamoyl]phenoxy]phenyl]propylamino]acetate |
|---|---|
| PubChem CID | 145039297 |
| Molecular Formula | C23H24Cl2FN3O4S2 |
| Molecular Weight | 560.50 g/mol |
| Exact Mass | 559.06 |
| IUPAC Name | ethyl 2-[3-[5-chloro-2-[2-chloro-5-fluoro-4-[methyl(1,3-thiazol-2-yl)sulfinamoyl]phenoxy]phenyl]propylamino]acetate |
| SMILES | CCOC(=O)CNCCCc1cc(Cl)ccc1Oc1cc(F)c(S(=O)N(C)c2nccs2)cc1Cl |
| InChI | InChI=1S/C23H24Cl2FN3O4S2/c1-3-32-22(30)14-27-8-4-5-15-11-16(24)6-7-19(15)33-20-13-18(26)21(12-17(20)25)35(31)29(2)23-28-9-10-34-23/h6-7,9-13,27H,3-5,8,14H2,1-2H3 |
| InChIKey | GLHKZGBFKKVJCA-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.50 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|