C20H18Cl2FN3O3S2 — CID 144807151
2-[3-[5-chloro-2-[2-chloro-5-fluoro-4-(1,3-thiazol-2-ylamino)sulfanylphenoxy]phenyl]propylamino]acetic acid (PubChem CID 144807151) has the molecular formula C20H18Cl2FN3O3S2 and a molecular weight of 502.42 g/mol. Its IUPAC name is 2-[3-[5-chloro-2-[2-chloro-5-fluoro-4-(1,3-thiazol-2-ylamino)sulfanylphenoxy]phenyl]propylamino]acetic acid.
| Compound Name | 2-[3-[5-chloro-2-[2-chloro-5-fluoro-4-(1,3-thiazol-2-ylamino)sulfanylphenoxy]phenyl]propylamino]acetic acid |
|---|---|
| PubChem CID | 144807151 |
| Molecular Formula | C20H18Cl2FN3O3S2 |
| Molecular Weight | 502.42 g/mol |
| Exact Mass | 501.02 |
| IUPAC Name | 2-[3-[5-chloro-2-[2-chloro-5-fluoro-4-(1,3-thiazol-2-ylamino)sulfanylphenoxy]phenyl]propylamino]acetic acid |
| SMILES | O=C(O)CNCCCc1cc(Cl)ccc1Oc1cc(F)c(SNc2nccs2)cc1Cl |
| InChI | InChI=1S/C20H18Cl2FN3O3S2/c21-13-3-4-16(12(8-13)2-1-5-24-11-19(27)28)29-17-10-15(23)18(9-14(17)22)31-26-20-25-6-7-30-20/h3-4,6-10,24H,1-2,5,11H2,(H,25,26)(H,27,28) |
| InChIKey | GTNZWSVEAPUDRJ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.42 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|