C10H9ClFN3S2 — CID 134477064
N-[5-chloro-2-fluoro-4-(methylamino)phenyl]sulfanyl-1,3-thiazol-2-amine (PubChem CID 134477064) has the molecular formula C10H9ClFN3S2 and a molecular weight of 289.79 g/mol. Its IUPAC name is N-[5-chloro-2-fluoro-4-(methylamino)phenyl]sulfanyl-1,3-thiazol-2-amine.
| Compound Name | N-[5-chloro-2-fluoro-4-(methylamino)phenyl]sulfanyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 134477064 |
| Molecular Formula | C10H9ClFN3S2 |
| Molecular Weight | 289.79 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | N-[5-chloro-2-fluoro-4-(methylamino)phenyl]sulfanyl-1,3-thiazol-2-amine |
| SMILES | CNc1cc(F)c(SNc2nccs2)cc1Cl |
| InChI | InChI=1S/C10H9ClFN3S2/c1-13-8-5-7(12)9(4-6(8)11)17-15-10-14-2-3-16-10/h2-5,13H,1H3,(H,14,15) |
| InChIKey | HUYCIDBXWGKGKP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.79 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|