C21H22ClFN4OS2 — CID 134602247
N-[5-chloro-2-fluoro-4-[(2-morpholin-4-yl-1-phenylethyl)amino]phenyl]sulfanyl-1,3-thiazol-2-amine (PubChem CID 134602247) has the molecular formula C21H22ClFN4OS2 and a molecular weight of 465.02 g/mol. Its IUPAC name is N-[5-chloro-2-fluoro-4-[(2-morpholin-4-yl-1-phenylethyl)amino]phenyl]sulfanyl-1,3-thiazol-2-amine.
| Compound Name | N-[5-chloro-2-fluoro-4-[(2-morpholin-4-yl-1-phenylethyl)amino]phenyl]sulfanyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 134602247 |
| Molecular Formula | C21H22ClFN4OS2 |
| Molecular Weight | 465.02 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | N-[5-chloro-2-fluoro-4-[(2-morpholin-4-yl-1-phenylethyl)amino]phenyl]sulfanyl-1,3-thiazol-2-amine |
| SMILES | Fc1cc(NC(CN2CCOCC2)c2ccccc2)c(Cl)cc1SNc1nccs1 |
| InChI | InChI=1S/C21H22ClFN4OS2/c22-16-12-20(30-26-21-24-6-11-29-21)17(23)13-18(16)25-19(15-4-2-1-3-5-15)14-27-7-9-28-10-8-27/h1-6,11-13,19,25H,7-10,14H2,(H,24,26) |
| InChIKey | HODVJRGQGWOIJA-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 49.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.02 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|