C16H12BrClFN3S2 — CID 134602204
N-[4-[(3-bromophenyl)methylamino]-5-chloro-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine (PubChem CID 134602204) has the molecular formula C16H12BrClFN3S2 and a molecular weight of 444.78 g/mol. Its IUPAC name is N-[4-[(3-bromophenyl)methylamino]-5-chloro-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine.
| Compound Name | N-[4-[(3-bromophenyl)methylamino]-5-chloro-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 134602204 |
| Molecular Formula | C16H12BrClFN3S2 |
| Molecular Weight | 444.78 g/mol |
| Exact Mass | 442.93 |
| IUPAC Name | N-[4-[(3-bromophenyl)methylamino]-5-chloro-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine |
| SMILES | Fc1cc(NCc2cccc(Br)c2)c(Cl)cc1SNc1nccs1 |
| InChI | InChI=1S/C16H12BrClFN3S2/c17-11-3-1-2-10(6-11)9-21-14-8-13(19)15(7-12(14)18)24-22-16-20-4-5-23-16/h1-8,21H,9H2,(H,20,22) |
| InChIKey | DDCZGSXVXUCZBR-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.78 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|