C25H18ClFN4OS2 — CID 178082783
N-[5-chloro-2-fluoro-4-[[4-(furan-3-yl)-6-(4-methylphenyl)-3-pyridinyl]amino]phenyl]sulfanyl-1,3-thiazol-2-amine (PubChem CID 178082783) has the molecular formula C25H18ClFN4OS2 and a molecular weight of 509.03 g/mol. Its IUPAC name is N-[5-chloro-2-fluoro-4-[[4-(furan-3-yl)-6-(4-methylphenyl)-3-pyridinyl]amino]phenyl]sulfanyl-1,3-thiazol-2-amine.
| Compound Name | N-[5-chloro-2-fluoro-4-[[4-(furan-3-yl)-6-(4-methylphenyl)-3-pyridinyl]amino]phenyl]sulfanyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 178082783 |
| Molecular Formula | C25H18ClFN4OS2 |
| Molecular Weight | 509.03 g/mol |
| Exact Mass | 508.06 |
| IUPAC Name | N-[5-chloro-2-fluoro-4-[[4-(furan-3-yl)-6-(4-methylphenyl)-3-pyridinyl]amino]phenyl]sulfanyl-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(-c2cc(-c3ccoc3)c(Nc3cc(F)c(SNc4nccs4)cc3Cl)cn2)cc1 |
| InChI | InChI=1S/C25H18ClFN4OS2/c1-15-2-4-16(5-3-15)21-10-18(17-6-8-32-14-17)23(13-29-21)30-22-12-20(27)24(11-19(22)26)34-31-25-28-7-9-33-25/h2-14,30H,1H3,(H,28,31) |
| InChIKey | WRQGJEKVLIOZQE-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.03 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|