C19H27ClFN5S2 — CID 170092394
N-[(3S)-azepan-3-yl]-N'-[2-chloro-5-fluoro-4-(1,3-thiazol-2-ylamino)sulfanylphenyl]butane-1,4-diamine (PubChem CID 170092394) has the molecular formula C19H27ClFN5S2 and a molecular weight of 444.05 g/mol. Its IUPAC name is N-[(3S)-azepan-3-yl]-N'-[2-chloro-5-fluoro-4-(1,3-thiazol-2-ylamino)sulfanylphenyl]butane-1,4-diamine.
| Compound Name | N-[(3S)-azepan-3-yl]-N'-[2-chloro-5-fluoro-4-(1,3-thiazol-2-ylamino)sulfanylphenyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 170092394 |
| Molecular Formula | C19H27ClFN5S2 |
| Molecular Weight | 444.05 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | N-[(3S)-azepan-3-yl]-N'-[2-chloro-5-fluoro-4-(1,3-thiazol-2-ylamino)sulfanylphenyl]butane-1,4-diamine |
| SMILES | Fc1cc(NCCCCN[C@H]2CCCCNC2)c(Cl)cc1SNc1nccs1 |
| InChI | InChI=1S/C19H27ClFN5S2/c20-15-11-18(28-26-19-25-9-10-27-19)16(21)12-17(15)24-8-4-3-7-23-14-5-1-2-6-22-13-14/h9-12,14,22-24H,1-8,13H2,(H,25,26)/t14-/m0/s1 |
| InChIKey | SWIVVLCGGRUHGT-AWEZNQCLSA-N |
| XLogP | 4.98 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.05 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|