C19H27ClFN5O2S2 — CID 155072684
5-chloro-2-fluoro-4-[4-[2-(hydroxymethyl)-1,4-diazepan-1-yl]butylamino]-N-(1,3-thiazol-2-yl)benzenesulfinamide (PubChem CID 155072684) has the molecular formula C19H27ClFN5O2S2 and a molecular weight of 476.04 g/mol. Its IUPAC name is 5-chloro-2-fluoro-4-[4-[2-(hydroxymethyl)-1,4-diazepan-1-yl]butylamino]-N-(1,3-thiazol-2-yl)benzenesulfinamide.
| Compound Name | 5-chloro-2-fluoro-4-[4-[2-(hydroxymethyl)-1,4-diazepan-1-yl]butylamino]-N-(1,3-thiazol-2-yl)benzenesulfinamide |
|---|---|
| PubChem CID | 155072684 |
| Molecular Formula | C19H27ClFN5O2S2 |
| Molecular Weight | 476.04 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 5-chloro-2-fluoro-4-[4-[2-(hydroxymethyl)-1,4-diazepan-1-yl]butylamino]-N-(1,3-thiazol-2-yl)benzenesulfinamide |
| SMILES | O=S(Nc1nccs1)c1cc(Cl)c(NCCCCN2CCCNCC2CO)cc1F |
| InChI | InChI=1S/C19H27ClFN5O2S2/c20-15-10-18(30(28)25-19-24-6-9-29-19)16(21)11-17(15)23-5-1-2-7-26-8-3-4-22-12-14(26)13-27/h6,9-11,14,22-23,27H,1-5,7-8,12-13H2,(H,24,25) |
| InChIKey | NQSIMWVOBCTYCU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.04 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|