C15H21ClFN5OS2 — CID 145336069
4-[4-(2-aminoethylamino)butylamino]-5-chloro-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfinamide (PubChem CID 145336069) has the molecular formula C15H21ClFN5OS2 and a molecular weight of 405.95 g/mol. Its IUPAC name is 4-[4-(2-aminoethylamino)butylamino]-5-chloro-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfinamide.
| Compound Name | 4-[4-(2-aminoethylamino)butylamino]-5-chloro-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfinamide |
|---|---|
| PubChem CID | 145336069 |
| Molecular Formula | C15H21ClFN5OS2 |
| Molecular Weight | 405.95 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 4-[4-(2-aminoethylamino)butylamino]-5-chloro-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfinamide |
| SMILES | NCCNCCCCNc1cc(F)c(S(=O)Nc2nccs2)cc1Cl |
| InChI | InChI=1S/C15H21ClFN5OS2/c16-11-9-14(25(23)22-15-21-7-8-24-15)12(17)10-13(11)20-5-2-1-4-19-6-3-18/h7-10,19-20H,1-6,18H2,(H,21,22) |
| InChIKey | HFMRHNHDFOTOAM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.95 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|