C18H24ClFN4OS2 — CID 129257903
5-chloro-4-[4-(cyclopentylamino)butylamino]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfinamide (PubChem CID 129257903) has the molecular formula C18H24ClFN4OS2 and a molecular weight of 431.00 g/mol. Its IUPAC name is 5-chloro-4-[4-(cyclopentylamino)butylamino]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfinamide.
| Compound Name | 5-chloro-4-[4-(cyclopentylamino)butylamino]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfinamide |
|---|---|
| PubChem CID | 129257903 |
| Molecular Formula | C18H24ClFN4OS2 |
| Molecular Weight | 431.00 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 5-chloro-4-[4-(cyclopentylamino)butylamino]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfinamide |
| SMILES | O=S(Nc1nccs1)c1cc(Cl)c(NCCCCNC2CCCC2)cc1F |
| InChI | InChI=1S/C18H24ClFN4OS2/c19-14-11-17(27(25)24-18-23-9-10-26-18)15(20)12-16(14)22-8-4-3-7-21-13-5-1-2-6-13/h9-13,21-22H,1-8H2,(H,23,24) |
| InChIKey | ODWYXAAZIHRKQQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.00 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|