C20H20ClF2N3O5S2 — CID 146254745
4-[4-chloro-2-[3-(2,2-dihydroxyethylamino)propyl]phenoxy]-2,5-difluoro-N-(1,3-thiazol-4-yl)benzenesulfonamide (PubChem CID 146254745) has the molecular formula C20H20ClF2N3O5S2 and a molecular weight of 519.98 g/mol. Its IUPAC name is 4-[4-chloro-2-[3-(2,2-dihydroxyethylamino)propyl]phenoxy]-2,5-difluoro-N-(1,3-thiazol-4-yl)benzenesulfonamide.
| Compound Name | 4-[4-chloro-2-[3-(2,2-dihydroxyethylamino)propyl]phenoxy]-2,5-difluoro-N-(1,3-thiazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 146254745 |
| Molecular Formula | C20H20ClF2N3O5S2 |
| Molecular Weight | 519.98 g/mol |
| Exact Mass | 519.05 |
| IUPAC Name | 4-[4-chloro-2-[3-(2,2-dihydroxyethylamino)propyl]phenoxy]-2,5-difluoro-N-(1,3-thiazol-4-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cscn1)c1cc(F)c(Oc2ccc(Cl)cc2CCCNCC(O)O)cc1F |
| InChI | InChI=1S/C20H20ClF2N3O5S2/c21-13-3-4-16(12(6-13)2-1-5-24-9-20(27)28)31-17-7-15(23)18(8-14(17)22)33(29,30)26-19-10-32-11-25-19/h3-4,6-8,10-11,20,24,26-28H,1-2,5,9H2 |
| InChIKey | PLICPBOBHPZNAI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.98 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|