C10H8F2N2O2S2 — CID 118121063
2,4-difluoro-5-methyl-N-(1,3-thiazol-4-yl)benzenesulfonamide (PubChem CID 118121063) has the molecular formula C10H8F2N2O2S2 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2,4-difluoro-5-methyl-N-(1,3-thiazol-4-yl)benzenesulfonamide.
| Compound Name | 2,4-difluoro-5-methyl-N-(1,3-thiazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 118121063 |
| Molecular Formula | C10H8F2N2O2S2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | 2,4-difluoro-5-methyl-N-(1,3-thiazol-4-yl)benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2cscn2)c(F)cc1F |
| InChI | InChI=1S/C10H8F2N2O2S2/c1-6-2-9(8(12)3-7(6)11)18(15,16)14-10-4-17-5-13-10/h2-5,14H,1H3 |
| InChIKey | KYHZSRJROFPDMK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |