C10H9FN2O2S2 — CID 174945014
2-fluoro-3-methyl-N-(1,3-thiazol-4-yl)benzenesulfonamide (PubChem CID 174945014) has the molecular formula C10H9FN2O2S2 and a molecular weight of 272.33 g/mol. Its IUPAC name is 2-fluoro-3-methyl-N-(1,3-thiazol-4-yl)benzenesulfonamide.
| Compound Name | 2-fluoro-3-methyl-N-(1,3-thiazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 174945014 |
| Molecular Formula | C10H9FN2O2S2 |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 2-fluoro-3-methyl-N-(1,3-thiazol-4-yl)benzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)Nc2cscn2)c1F |
| InChI | InChI=1S/C10H9FN2O2S2/c1-7-3-2-4-8(10(7)11)17(14,15)13-9-5-16-6-12-9/h2-6,13H,1H3 |
| InChIKey | APJPDQWBRAZYJH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |