C12H12FN3O4S — CID 138044503
3-[(2-fluoro-3-methylphenyl)sulfonylamino]-1-methylpyrazole-5-carboxylic acid (PubChem CID 138044503) has the molecular formula C12H12FN3O4S and a molecular weight of 313.31 g/mol. Its IUPAC name is 3-[(2-fluoro-3-methylphenyl)sulfonylamino]-1-methylpyrazole-5-carboxylic acid.
| Compound Name | 3-[(2-fluoro-3-methylphenyl)sulfonylamino]-1-methylpyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 138044503 |
| Molecular Formula | C12H12FN3O4S |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 3-[(2-fluoro-3-methylphenyl)sulfonylamino]-1-methylpyrazole-5-carboxylic acid |
| SMILES | Cc1cccc(S(=O)(=O)Nc2cc(C(=O)O)n(C)n2)c1F |
| InChI | InChI=1S/C12H12FN3O4S/c1-7-4-3-5-9(11(7)13)21(19,20)15-10-6-8(12(17)18)16(2)14-10/h3-6H,1-2H3,(H,14,15)(H,17,18) |
| InChIKey | SNNAKYKJGBCSMB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |