C11H10F3N3O2S — CID 3730633
N-(2,5-dimethylpyrazol-3-yl)-2,3,4-trifluorobenzenesulfonamide (PubChem CID 3730633) has the molecular formula C11H10F3N3O2S and a molecular weight of 305.28 g/mol. Its IUPAC name is N-(2,5-dimethylpyrazol-3-yl)-2,3,4-trifluorobenzenesulfonamide.
| Compound Name | N-(2,5-dimethylpyrazol-3-yl)-2,3,4-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 3730633 |
| Molecular Formula | C11H10F3N3O2S |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | N-(2,5-dimethylpyrazol-3-yl)-2,3,4-trifluorobenzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(F)c(F)c2F)n(C)n1 |
| InChI | InChI=1S/C11H10F3N3O2S/c1-6-5-9(17(2)15-6)16-20(18,19)8-4-3-7(12)10(13)11(8)14/h3-5,16H,1-2H3 |
| InChIKey | UPTHTODYYJZLIR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|