C11H11BrN4O4S — CID 61016944
5-bromo-N-(2,5-dimethylpyrazol-3-yl)-2-nitrobenzenesulfonamide (PubChem CID 61016944) has the molecular formula C11H11BrN4O4S and a molecular weight of 375.20 g/mol. Its IUPAC name is 5-bromo-N-(2,5-dimethylpyrazol-3-yl)-2-nitrobenzenesulfonamide.
| Compound Name | 5-bromo-N-(2,5-dimethylpyrazol-3-yl)-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 61016944 |
| Molecular Formula | C11H11BrN4O4S |
| Molecular Weight | 375.20 g/mol |
| Exact Mass | 373.97 |
| IUPAC Name | 5-bromo-N-(2,5-dimethylpyrazol-3-yl)-2-nitrobenzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cc(Br)ccc2[N+](=O)[O-])n(C)n1 |
| InChI | InChI=1S/C11H11BrN4O4S/c1-7-5-11(15(2)13-7)14-21(19,20)10-6-8(12)3-4-9(10)16(17)18/h3-6,14H,1-2H3 |
| InChIKey | DCXQNHQKQSZGDC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|