C14H10F3N5O2S — CID 25419429
2,3,4-trifluoro-N-[3-(1-methyltetrazol-5-yl)phenyl]benzenesulfonamide (PubChem CID 25419429) has the molecular formula C14H10F3N5O2S and a molecular weight of 369.33 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[3-(1-methyltetrazol-5-yl)phenyl]benzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-[3-(1-methyltetrazol-5-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25419429 |
| Molecular Formula | C14H10F3N5O2S |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 2,3,4-trifluoro-N-[3-(1-methyltetrazol-5-yl)phenyl]benzenesulfonamide |
| SMILES | Cn1nnnc1-c1cccc(NS(=O)(=O)c2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C14H10F3N5O2S/c1-22-14(18-20-21-22)8-3-2-4-9(7-8)19-25(23,24)11-6-5-10(15)12(16)13(11)17/h2-7,19H,1H3 |
| InChIKey | QJBKCOGGPFRMDI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|