C17H19N5O4S — CID 30868046
4-(2-methoxyethoxy)-N-[3-(1-methyltetrazol-5-yl)phenyl]benzenesulfonamide (PubChem CID 30868046) has the molecular formula C17H19N5O4S and a molecular weight of 389.44 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)-N-[3-(1-methyltetrazol-5-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-(2-methoxyethoxy)-N-[3-(1-methyltetrazol-5-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 30868046 |
| Molecular Formula | C17H19N5O4S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 4-(2-methoxyethoxy)-N-[3-(1-methyltetrazol-5-yl)phenyl]benzenesulfonamide |
| SMILES | COCCOc1ccc(S(=O)(=O)Nc2cccc(-c3nnnn3C)c2)cc1 |
| InChI | InChI=1S/C17H19N5O4S/c1-22-17(18-20-21-22)13-4-3-5-14(12-13)19-27(23,24)16-8-6-15(7-9-16)26-11-10-25-2/h3-9,12,19H,10-11H2,1-2H3 |
| InChIKey | LYZDGTZDIOZLHP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|