C16H17N5O2S — CID 25419462
4-ethyl-N-[3-(1-methyltetrazol-5-yl)phenyl]benzenesulfonamide (PubChem CID 25419462) has the molecular formula C16H17N5O2S and a molecular weight of 343.41 g/mol. Its IUPAC name is 4-ethyl-N-[3-(1-methyltetrazol-5-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-ethyl-N-[3-(1-methyltetrazol-5-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25419462 |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 4-ethyl-N-[3-(1-methyltetrazol-5-yl)phenyl]benzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2cccc(-c3nnnn3C)c2)cc1 |
| InChI | InChI=1S/C16H17N5O2S/c1-3-12-7-9-15(10-8-12)24(22,23)18-14-6-4-5-13(11-14)16-17-19-20-21(16)2/h4-11,18H,3H2,1-2H3 |
| InChIKey | HWYSCMFERJBASG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |