C20H25N7O3S — CID 55601078
N-[3-(diethylsulfamoyl)phenyl]-2-[3-(1-methyltetrazol-5-yl)anilino]acetamide (PubChem CID 55601078) has the molecular formula C20H25N7O3S and a molecular weight of 443.53 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)phenyl]-2-[3-(1-methyltetrazol-5-yl)anilino]acetamide.
| Compound Name | N-[3-(diethylsulfamoyl)phenyl]-2-[3-(1-methyltetrazol-5-yl)anilino]acetamide |
|---|---|
| PubChem CID | 55601078 |
| Molecular Formula | C20H25N7O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | N-[3-(diethylsulfamoyl)phenyl]-2-[3-(1-methyltetrazol-5-yl)anilino]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(NC(=O)CNc2cccc(-c3nnnn3C)c2)c1 |
| InChI | InChI=1S/C20H25N7O3S/c1-4-27(5-2)31(29,30)18-11-7-10-17(13-18)22-19(28)14-21-16-9-6-8-15(12-16)20-23-24-25-26(20)3/h6-13,21H,4-5,14H2,1-3H3,(H,22,28) |
| InChIKey | ZYURZZRUNJUMBR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |