C22H20N6O2 — CID 55544703
2-[3-(1-methyltetrazol-5-yl)anilino]-N-(4-phenoxyphenyl)acetamide (PubChem CID 55544703) has the molecular formula C22H20N6O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-[3-(1-methyltetrazol-5-yl)anilino]-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-[3-(1-methyltetrazol-5-yl)anilino]-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 55544703 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2-[3-(1-methyltetrazol-5-yl)anilino]-N-(4-phenoxyphenyl)acetamide |
| SMILES | Cn1nnnc1-c1cccc(NCC(=O)Nc2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C22H20N6O2/c1-28-22(25-26-27-28)16-6-5-7-18(14-16)23-15-21(29)24-17-10-12-20(13-11-17)30-19-8-3-2-4-9-19/h2-14,23H,15H2,1H3,(H,24,29) |
| InChIKey | OKAZWZXSNNLLMR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |