C17H26N8O3S — CID 55698877
4-(diethylsulfamoyl)-N-[3-(1-methyltetrazol-5-yl)phenyl]piperazine-1-carboxamide (PubChem CID 55698877) has the molecular formula C17H26N8O3S and a molecular weight of 422.52 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-[3-(1-methyltetrazol-5-yl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-(diethylsulfamoyl)-N-[3-(1-methyltetrazol-5-yl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55698877 |
| Molecular Formula | C17H26N8O3S |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-[3-(1-methyltetrazol-5-yl)phenyl]piperazine-1-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(C(=O)Nc2cccc(-c3nnnn3C)c2)CC1 |
| InChI | InChI=1S/C17H26N8O3S/c1-4-24(5-2)29(27,28)25-11-9-23(10-12-25)17(26)18-15-8-6-7-14(13-15)16-19-20-21-22(16)3/h6-8,13H,4-5,9-12H2,1-3H3,(H,18,26) |
| InChIKey | LIGYAMVHVUGOCF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |