C15H9ClF2N2O3S2 — CID 141418403
4-(4-chlorophenoxy)-2,5-difluoro-N-(1,3-thiazol-4-yl)benzenesulfonamide (PubChem CID 141418403) has the molecular formula C15H9ClF2N2O3S2 and a molecular weight of 402.83 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-2,5-difluoro-N-(1,3-thiazol-4-yl)benzenesulfonamide.
| Compound Name | 4-(4-chlorophenoxy)-2,5-difluoro-N-(1,3-thiazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 141418403 |
| Molecular Formula | C15H9ClF2N2O3S2 |
| Molecular Weight | 402.83 g/mol |
| Exact Mass | 401.97 |
| IUPAC Name | 4-(4-chlorophenoxy)-2,5-difluoro-N-(1,3-thiazol-4-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cscn1)c1cc(F)c(Oc2ccc(Cl)cc2)cc1F |
| InChI | InChI=1S/C15H9ClF2N2O3S2/c16-9-1-3-10(4-2-9)23-13-5-12(18)14(6-11(13)17)25(21,22)20-15-7-24-8-19-15/h1-8,20H |
| InChIKey | XLJXNGQZSJDIQC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.83 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |