C20H22ClF2N5O2S2 — CID 146493177
4-[[4-chloro-2-[2-(ethylamino)ethylamino]phenyl]methylamino]-2,5-difluoro-N-(1,3-thiazol-4-yl)benzenesulfonamide (PubChem CID 146493177) has the molecular formula C20H22ClF2N5O2S2 and a molecular weight of 502.01 g/mol. Its IUPAC name is 4-[[4-chloro-2-[2-(ethylamino)ethylamino]phenyl]methylamino]-2,5-difluoro-N-(1,3-thiazol-4-yl)benzenesulfonamide.
| Compound Name | 4-[[4-chloro-2-[2-(ethylamino)ethylamino]phenyl]methylamino]-2,5-difluoro-N-(1,3-thiazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 146493177 |
| Molecular Formula | C20H22ClF2N5O2S2 |
| Molecular Weight | 502.01 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | 4-[[4-chloro-2-[2-(ethylamino)ethylamino]phenyl]methylamino]-2,5-difluoro-N-(1,3-thiazol-4-yl)benzenesulfonamide |
| SMILES | CCNCCNc1cc(Cl)ccc1CNc1cc(F)c(S(=O)(=O)Nc2cscn2)cc1F |
| InChI | InChI=1S/C20H22ClF2N5O2S2/c1-2-24-5-6-25-17-7-14(21)4-3-13(17)10-26-18-8-16(23)19(9-15(18)22)32(29,30)28-20-11-31-12-27-20/h3-4,7-9,11-12,24-26,28H,2,5-6,10H2,1H3 |
| InChIKey | BDLNENLPZAAEFD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.01 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|