C22H24ClF2N5OS — CID 151233010
4-[[4-chloro-2-[3-(ethylamino)propylamino]phenyl]methylamino]-2,5-difluoro-N-(1,3-thiazol-4-yl)benzamide (PubChem CID 151233010) has the molecular formula C22H24ClF2N5OS and a molecular weight of 479.98 g/mol. Its IUPAC name is 4-[[4-chloro-2-[3-(ethylamino)propylamino]phenyl]methylamino]-2,5-difluoro-N-(1,3-thiazol-4-yl)benzamide.
| Compound Name | 4-[[4-chloro-2-[3-(ethylamino)propylamino]phenyl]methylamino]-2,5-difluoro-N-(1,3-thiazol-4-yl)benzamide |
|---|---|
| PubChem CID | 151233010 |
| Molecular Formula | C22H24ClF2N5OS |
| Molecular Weight | 479.98 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 4-[[4-chloro-2-[3-(ethylamino)propylamino]phenyl]methylamino]-2,5-difluoro-N-(1,3-thiazol-4-yl)benzamide |
| SMILES | CCNCCCNc1cc(Cl)ccc1CNc1cc(F)c(C(=O)Nc2cscn2)cc1F |
| InChI | InChI=1S/C22H24ClF2N5OS/c1-2-26-6-3-7-27-19-8-15(23)5-4-14(19)11-28-20-10-17(24)16(9-18(20)25)22(31)30-21-12-32-13-29-21/h4-5,8-10,12-13,26-28H,2-3,6-7,11H2,1H3,(H,30,31) |
| InChIKey | NORPPCXYKBHSRH-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.98 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|