C22H27F2N5S2 — CID 146493182
N'-[2-[[2,5-difluoro-4-(1,3-thiazol-2-ylamino)sulfanylanilino]methyl]-5-methylphenyl]-N-ethylpropane-1,3-diamine (PubChem CID 146493182) has the molecular formula C22H27F2N5S2 and a molecular weight of 463.62 g/mol. Its IUPAC name is N'-[2-[[2,5-difluoro-4-(1,3-thiazol-2-ylamino)sulfanylanilino]methyl]-5-methylphenyl]-N-ethylpropane-1,3-diamine.
| Compound Name | N'-[2-[[2,5-difluoro-4-(1,3-thiazol-2-ylamino)sulfanylanilino]methyl]-5-methylphenyl]-N-ethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 146493182 |
| Molecular Formula | C22H27F2N5S2 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | N'-[2-[[2,5-difluoro-4-(1,3-thiazol-2-ylamino)sulfanylanilino]methyl]-5-methylphenyl]-N-ethylpropane-1,3-diamine |
| SMILES | CCNCCCNc1cc(C)ccc1CNc1cc(F)c(SNc2nccs2)cc1F |
| InChI | InChI=1S/C22H27F2N5S2/c1-3-25-7-4-8-26-19-11-15(2)5-6-16(19)14-28-20-12-18(24)21(13-17(20)23)31-29-22-27-9-10-30-22/h5-6,9-13,25-26,28H,3-4,7-8,14H2,1-2H3,(H,27,29) |
| InChIKey | TXHFTZKTJXSEEO-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|