C16H12BrF3N4O2S2 — CID 146565805
5-[(2-bromo-3,6-difluorophenyl)methylamino]-3-fluoro-6-methyl-N-(1,3-thiazol-4-yl)pyridine-2-sulfonamide (PubChem CID 146565805) has the molecular formula C16H12BrF3N4O2S2 and a molecular weight of 493.33 g/mol. Its IUPAC name is 5-[(2-bromo-3,6-difluorophenyl)methylamino]-3-fluoro-6-methyl-N-(1,3-thiazol-4-yl)pyridine-2-sulfonamide.
| Compound Name | 5-[(2-bromo-3,6-difluorophenyl)methylamino]-3-fluoro-6-methyl-N-(1,3-thiazol-4-yl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 146565805 |
| Molecular Formula | C16H12BrF3N4O2S2 |
| Molecular Weight | 493.33 g/mol |
| Exact Mass | 491.95 |
| IUPAC Name | 5-[(2-bromo-3,6-difluorophenyl)methylamino]-3-fluoro-6-methyl-N-(1,3-thiazol-4-yl)pyridine-2-sulfonamide |
| SMILES | Cc1nc(S(=O)(=O)Nc2cscn2)c(F)cc1NCc1c(F)ccc(F)c1Br |
| InChI | InChI=1S/C16H12BrF3N4O2S2/c1-8-13(21-5-9-10(18)2-3-11(19)15(9)17)4-12(20)16(23-8)28(25,26)24-14-6-27-7-22-14/h2-4,6-7,21,24H,5H2,1H3 |
| InChIKey | KZMGUTIQLABKCR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.33 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|