C18H16ClFN4OS2 — CID 145181835
N-[5-chloro-2-fluoro-4-(1,2,3,4-tetrahydroisoquinolin-8-ylmethoxy)phenyl]sulfanyl-1,3,4-thiadiazol-2-amine (PubChem CID 145181835) has the molecular formula C18H16ClFN4OS2 and a molecular weight of 422.94 g/mol. Its IUPAC name is N-[5-chloro-2-fluoro-4-(1,2,3,4-tetrahydroisoquinolin-8-ylmethoxy)phenyl]sulfanyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[5-chloro-2-fluoro-4-(1,2,3,4-tetrahydroisoquinolin-8-ylmethoxy)phenyl]sulfanyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 145181835 |
| Molecular Formula | C18H16ClFN4OS2 |
| Molecular Weight | 422.94 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | N-[5-chloro-2-fluoro-4-(1,2,3,4-tetrahydroisoquinolin-8-ylmethoxy)phenyl]sulfanyl-1,3,4-thiadiazol-2-amine |
| SMILES | Fc1cc(OCc2cccc3c2CNCC3)c(Cl)cc1SNc1nncs1 |
| InChI | InChI=1S/C18H16ClFN4OS2/c19-14-6-17(27-24-18-23-22-10-26-18)15(20)7-16(14)25-9-12-3-1-2-11-4-5-21-8-13(11)12/h1-3,6-7,10,21H,4-5,8-9H2,(H,23,24) |
| InChIKey | WNKJENNIBNMMFZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.94 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|