C17H14ClFN4OS2 — CID 145181904
N-[5-chloro-2-fluoro-4-(1,2,3,4-tetrahydroisoquinolin-5-yloxy)phenyl]sulfanyl-1,3,4-thiadiazol-2-amine (PubChem CID 145181904) has the molecular formula C17H14ClFN4OS2 and a molecular weight of 408.91 g/mol. Its IUPAC name is N-[5-chloro-2-fluoro-4-(1,2,3,4-tetrahydroisoquinolin-5-yloxy)phenyl]sulfanyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[5-chloro-2-fluoro-4-(1,2,3,4-tetrahydroisoquinolin-5-yloxy)phenyl]sulfanyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 145181904 |
| Molecular Formula | C17H14ClFN4OS2 |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | N-[5-chloro-2-fluoro-4-(1,2,3,4-tetrahydroisoquinolin-5-yloxy)phenyl]sulfanyl-1,3,4-thiadiazol-2-amine |
| SMILES | Fc1cc(Oc2cccc3c2CCNC3)c(Cl)cc1SNc1nncs1 |
| InChI | InChI=1S/C17H14ClFN4OS2/c18-12-6-16(26-23-17-22-21-9-25-17)13(19)7-15(12)24-14-3-1-2-10-8-20-5-4-11(10)14/h1-3,6-7,9,20H,4-5,8H2,(H,22,23) |
| InChIKey | ZULUEKSLYWHSHY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|