C25H28ClFN4O3S2 — CID 118109220
5-chloro-2-fluoro-4-[[(2R,8S)-2-[(4-methoxyphenyl)methyl]-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]-methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 118109220) has the molecular formula C25H28ClFN4O3S2 and a molecular weight of 551.11 g/mol. Its IUPAC name is 5-chloro-2-fluoro-4-[[(2R,8S)-2-[(4-methoxyphenyl)methyl]-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]-methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 5-chloro-2-fluoro-4-[[(2R,8S)-2-[(4-methoxyphenyl)methyl]-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]-methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 118109220 |
| Molecular Formula | C25H28ClFN4O3S2 |
| Molecular Weight | 551.11 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | 5-chloro-2-fluoro-4-[[(2R,8S)-2-[(4-methoxyphenyl)methyl]-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]-methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | COc1ccc(C[C@H]2CN3CCC[C@]3(N(C)c3cc(F)c(S(=O)(=O)Nc4nccs4)cc3Cl)C2)cc1 |
| InChI | InChI=1S/C25H28ClFN4O3S2/c1-30(22-14-21(27)23(13-20(22)26)36(32,33)29-24-28-9-11-35-24)25-8-3-10-31(25)16-18(15-25)12-17-4-6-19(34-2)7-5-17/h4-7,9,11,13-14,18H,3,8,10,12,15-16H2,1-2H3,(H,28,29)/t18-,25-/m1/s1 |
| InChIKey | RCPCJSINKIITII-IQGLISFBSA-N |
| XLogP | 5.24 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.11 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |