C27H33FN4O3S2 — CID 118109004
5-ethyl-2-fluoro-4-[[(2R,8S)-2-[(4-methoxyphenyl)methyl]-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 118109004) has the molecular formula C27H33FN4O3S2 and a molecular weight of 544.72 g/mol. Its IUPAC name is 5-ethyl-2-fluoro-4-[[(2R,8S)-2-[(4-methoxyphenyl)methyl]-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 5-ethyl-2-fluoro-4-[[(2R,8S)-2-[(4-methoxyphenyl)methyl]-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 118109004 |
| Molecular Formula | C27H33FN4O3S2 |
| Molecular Weight | 544.72 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | 5-ethyl-2-fluoro-4-[[(2R,8S)-2-[(4-methoxyphenyl)methyl]-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | CCc1cc(S(=O)(=O)Nc2nccs2)c(F)cc1NC[C@@]12CCCN1C[C@H](Cc1ccc(OC)cc1)C2 |
| InChI | InChI=1S/C27H33FN4O3S2/c1-3-21-14-25(37(33,34)31-26-29-10-12-36-26)23(28)15-24(21)30-18-27-9-4-11-32(27)17-20(16-27)13-19-5-7-22(35-2)8-6-19/h5-8,10,12,14-15,20,30H,3-4,9,11,13,16-18H2,1-2H3,(H,29,31)/t20-,27+/m1/s1 |
| InChIKey | OKMXBVIPHABWGI-HRFSGMKKSA-N |
| XLogP | 5.16 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.72 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |