C19H23F3N4O2S2 — CID 118109335
4-[[(3S,8R)-3-methyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methylamino]-N-(1,3-thiazol-2-yl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 118109335) has the molecular formula C19H23F3N4O2S2 and a molecular weight of 460.55 g/mol. Its IUPAC name is 4-[[(3S,8R)-3-methyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methylamino]-N-(1,3-thiazol-2-yl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-[[(3S,8R)-3-methyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methylamino]-N-(1,3-thiazol-2-yl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 118109335 |
| Molecular Formula | C19H23F3N4O2S2 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 4-[[(3S,8R)-3-methyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methylamino]-N-(1,3-thiazol-2-yl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | C[C@H]1CC[C@@]2(CNc3ccc(S(=O)(=O)Nc4nccs4)cc3C(F)(F)F)CCCN12 |
| InChI | InChI=1S/C19H23F3N4O2S2/c1-13-5-7-18(6-2-9-26(13)18)12-24-16-4-3-14(11-15(16)19(20,21)22)30(27,28)25-17-23-8-10-29-17/h3-4,8,10-11,13,24H,2,5-7,9,12H2,1H3,(H,23,25)/t13-,18+/m0/s1 |
| InChIKey | CZZVYRAJBHRGRK-SCLBCKFNSA-N |
| XLogP | 4.39 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |