C18H22ClFN4O3S2 — CID 118109438
3-chloro-2-fluoro-4-[[3-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 118109438) has the molecular formula C18H22ClFN4O3S2 and a molecular weight of 460.98 g/mol. Its IUPAC name is 3-chloro-2-fluoro-4-[[3-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 3-chloro-2-fluoro-4-[[3-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 118109438 |
| Molecular Formula | C18H22ClFN4O3S2 |
| Molecular Weight | 460.98 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | 3-chloro-2-fluoro-4-[[3-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nccs1)c1ccc(NCC23CCCN2C(CO)CC3)c(Cl)c1F |
| InChI | InChI=1S/C18H22ClFN4O3S2/c19-15-13(22-11-18-5-1-8-24(18)12(10-25)4-6-18)2-3-14(16(15)20)29(26,27)23-17-21-7-9-28-17/h2-3,7,9,12,22,25H,1,4-6,8,10-11H2,(H,21,23) |
| InChIKey | OBSNDPZKGUPWNR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.98 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |