C21H26F3N5O2S2 — CID 140761473
5-cyano-4-[(6,6-dimethyl-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methylamino]-N-(1,3-thiazol-2-yl)-5-(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonamide (PubChem CID 140761473) has the molecular formula C21H26F3N5O2S2 and a molecular weight of 501.60 g/mol. Its IUPAC name is 5-cyano-4-[(6,6-dimethyl-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methylamino]-N-(1,3-thiazol-2-yl)-5-(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonamide.
| Compound Name | 5-cyano-4-[(6,6-dimethyl-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methylamino]-N-(1,3-thiazol-2-yl)-5-(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonamide |
|---|---|
| PubChem CID | 140761473 |
| Molecular Formula | C21H26F3N5O2S2 |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 5-cyano-4-[(6,6-dimethyl-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methylamino]-N-(1,3-thiazol-2-yl)-5-(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonamide |
| SMILES | CC1(C)CN2CCCC2(CNC2=CC=C(S(=O)(=O)Nc3nccs3)CC2(C#N)C(F)(F)F)C1 |
| InChI | InChI=1S/C21H26F3N5O2S2/c1-18(2)11-19(6-3-8-29(19)14-18)13-27-16-5-4-15(10-20(16,12-25)21(22,23)24)33(30,31)28-17-26-7-9-32-17/h4-5,7,9,27H,3,6,8,10-11,13-14H2,1-2H3,(H,26,28) |
| InChIKey | YDNSLHWNGMRIIR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |