C18H21N5O2S2 — CID 118109394
N-cyano-4-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethylamino)-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 118109394) has the molecular formula C18H21N5O2S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is N-cyano-4-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethylamino)-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | N-cyano-4-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethylamino)-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 118109394 |
| Molecular Formula | C18H21N5O2S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | N-cyano-4-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethylamino)-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | N#CN(c1nccs1)S(=O)(=O)c1ccc(NCC23CCCN2CCC3)cc1 |
| InChI | InChI=1S/C18H21N5O2S2/c19-14-23(17-20-9-12-26-17)27(24,25)16-5-3-15(4-6-16)21-13-18-7-1-10-22(18)11-2-8-18/h3-6,9,12,21H,1-2,7-8,10-11,13H2 |
| InChIKey | WJXUZSLNQXRTAR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|