C20H32N4O2S2 — CID 78871067
5-piperidin-1-ylsulfonyl-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]pyridin-2-amine (PubChem CID 78871067) has the molecular formula C20H32N4O2S2 and a molecular weight of 424.64 g/mol. Its IUPAC name is 5-piperidin-1-ylsulfonyl-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]pyridin-2-amine.
| Compound Name | 5-piperidin-1-ylsulfonyl-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 78871067 |
| Molecular Formula | C20H32N4O2S2 |
| Molecular Weight | 424.64 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 5-piperidin-1-ylsulfonyl-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]pyridin-2-amine |
| SMILES | O=S(=O)(c1ccc(NCC2(N3CCSCC3)CCCC2)nc1)N1CCCCC1 |
| InChI | InChI=1S/C20H32N4O2S2/c25-28(26,24-10-4-1-5-11-24)18-6-7-19(21-16-18)22-17-20(8-2-3-9-20)23-12-14-27-15-13-23/h6-7,16H,1-5,8-15,17H2,(H,21,22) |
| InChIKey | KTSQACNCOQBLNF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.64 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |