C11H18N4O3S — CID 115355870
2-[(6-amino-3-pyridinyl)sulfonylamino]-N-tert-butylacetamide (PubChem CID 115355870) has the molecular formula C11H18N4O3S and a molecular weight of 286.36 g/mol. Its IUPAC name is 2-[(6-amino-3-pyridinyl)sulfonylamino]-N-tert-butylacetamide.
| Compound Name | 2-[(6-amino-3-pyridinyl)sulfonylamino]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 115355870 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 2-[(6-amino-3-pyridinyl)sulfonylamino]-N-tert-butylacetamide |
| SMILES | CC(C)(C)NC(=O)CNS(=O)(=O)c1ccc(N)nc1 |
| InChI | InChI=1S/C11H18N4O3S/c1-11(2,3)15-10(16)7-14-19(17,18)8-4-5-9(12)13-6-8/h4-6,14H,7H2,1-3H3,(H2,12,13)(H,15,16) |
| InChIKey | GYLSSXTZLOLMLQ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |