C8H12N4O3S — CID 116645965
1-[(6-amino-3-pyridinyl)sulfonyl]-3-ethylurea (PubChem CID 116645965) has the molecular formula C8H12N4O3S and a molecular weight of 244.28 g/mol. Its IUPAC name is 1-[(6-amino-3-pyridinyl)sulfonyl]-3-ethylurea.
| Compound Name | 1-[(6-amino-3-pyridinyl)sulfonyl]-3-ethylurea |
|---|---|
| PubChem CID | 116645965 |
| Molecular Formula | C8H12N4O3S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 1-[(6-amino-3-pyridinyl)sulfonyl]-3-ethylurea |
| SMILES | CCNC(=O)NS(=O)(=O)c1ccc(N)nc1 |
| InChI | InChI=1S/C8H12N4O3S/c1-2-10-8(13)12-16(14,15)6-3-4-7(9)11-5-6/h3-5H,2H2,1H3,(H2,9,11)(H2,10,12,13) |
| InChIKey | FLSNJPXYFAXSOA-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |