C10H19N5O3S — CID 115355880
2-[(3-amino-1-methylpyrazol-4-yl)sulfonylamino]-N-tert-butylacetamide (PubChem CID 115355880) has the molecular formula C10H19N5O3S and a molecular weight of 289.36 g/mol. Its IUPAC name is 2-[(3-amino-1-methylpyrazol-4-yl)sulfonylamino]-N-tert-butylacetamide.
| Compound Name | 2-[(3-amino-1-methylpyrazol-4-yl)sulfonylamino]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 115355880 |
| Molecular Formula | C10H19N5O3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-[(3-amino-1-methylpyrazol-4-yl)sulfonylamino]-N-tert-butylacetamide |
| SMILES | Cn1cc(S(=O)(=O)NCC(=O)NC(C)(C)C)c(N)n1 |
| InChI | InChI=1S/C10H19N5O3S/c1-10(2,3)13-8(16)5-12-19(17,18)7-6-15(4)14-9(7)11/h6,12H,5H2,1-4H3,(H2,11,14)(H,13,16) |
| InChIKey | AILASSQPLAIPOI-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |