C14H20N4O2S — CID 43456648
2-hydrazinyl-N-pentan-2-ylquinoline-6-sulfonamide (PubChem CID 43456648) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 2-hydrazinyl-N-pentan-2-ylquinoline-6-sulfonamide.
| Compound Name | 2-hydrazinyl-N-pentan-2-ylquinoline-6-sulfonamide |
|---|---|
| PubChem CID | 43456648 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-hydrazinyl-N-pentan-2-ylquinoline-6-sulfonamide |
| SMILES | CCCC(C)NS(=O)(=O)c1ccc2nc(NN)ccc2c1 |
| InChI | InChI=1S/C14H20N4O2S/c1-3-4-10(2)18-21(19,20)12-6-7-13-11(9-12)5-8-14(16-13)17-15/h5-10,18H,3-4,15H2,1-2H3,(H,16,17) |
| InChIKey | MWZXXMUZQYUKIR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|