C14H24N4O2S — CID 63980020
1-methyl-5-[(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)sulfonyl]imidazol-4-amine (PubChem CID 63980020) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is 1-methyl-5-[(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)sulfonyl]imidazol-4-amine.
| Compound Name | 1-methyl-5-[(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)sulfonyl]imidazol-4-amine |
|---|---|
| PubChem CID | 63980020 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-methyl-5-[(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)sulfonyl]imidazol-4-amine |
| SMILES | CC1CCN(S(=O)(=O)c2c(N)ncn2C)C2CCCCC12 |
| InChI | InChI=1S/C14H24N4O2S/c1-10-7-8-18(12-6-4-3-5-11(10)12)21(19,20)14-13(15)16-9-17(14)2/h9-12H,3-8,15H2,1-2H3 |
| InChIKey | QLJAIRKTCNDRFH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |