C11H21NO2S — CID 124790308
(4R,4aS,8aS)-4-methyl-1-methylsulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 124790308) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is (4R,4aS,8aS)-4-methyl-1-methylsulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | (4R,4aS,8aS)-4-methyl-1-methylsulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 124790308 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | (4R,4aS,8aS)-4-methyl-1-methylsulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | C[C@@H]1CCN(S(C)(=O)=O)[C@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C11H21NO2S/c1-9-7-8-12(15(2,13)14)11-6-4-3-5-10(9)11/h9-11H,3-8H2,1-2H3/t9-,10+,11+/m1/s1 |
| InChIKey | MGXCXOSKJRYCHI-VWYCJHECSA-N |
| XLogP | 1.85 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |