C20H27NO6S — CID 55682152
dimethyl 5-[(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)sulfonyl]benzene-1,3-dicarboxylate (PubChem CID 55682152) has the molecular formula C20H27NO6S and a molecular weight of 409.50 g/mol. Its IUPAC name is dimethyl 5-[(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)sulfonyl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)sulfonyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 55682152 |
| Molecular Formula | C20H27NO6S |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | dimethyl 5-[(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)sulfonyl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(S(=O)(=O)N2CCC(C)C3CCCCC32)c1 |
| InChI | InChI=1S/C20H27NO6S/c1-13-8-9-21(18-7-5-4-6-17(13)18)28(24,25)16-11-14(19(22)26-2)10-15(12-16)20(23)27-3/h10-13,17-18H,4-9H2,1-3H3 |
| InChIKey | LVOYBYRYEGREKC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |