C9H15ClN4O3S — CID 47256582
2-[(5-chloro-1-methylimidazol-4-yl)sulfonyl-methylamino]-N-ethylacetamide (PubChem CID 47256582) has the molecular formula C9H15ClN4O3S and a molecular weight of 294.76 g/mol. Its IUPAC name is 2-[(5-chloro-1-methylimidazol-4-yl)sulfonyl-methylamino]-N-ethylacetamide.
| Compound Name | 2-[(5-chloro-1-methylimidazol-4-yl)sulfonyl-methylamino]-N-ethylacetamide |
|---|---|
| PubChem CID | 47256582 |
| Molecular Formula | C9H15ClN4O3S |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 2-[(5-chloro-1-methylimidazol-4-yl)sulfonyl-methylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CN(C)S(=O)(=O)c1ncn(C)c1Cl |
| InChI | InChI=1S/C9H15ClN4O3S/c1-4-11-7(15)5-14(3)18(16,17)9-8(10)13(2)6-12-9/h6H,4-5H2,1-3H3,(H,11,15) |
| InChIKey | GSFZNGBSNYNSMX-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |