C8H15ClN4O4S2 — CID 113233818
5-chloro-N-[2-(ethylsulfamoyl)ethyl]-1-methylimidazole-4-sulfonamide (PubChem CID 113233818) has the molecular formula C8H15ClN4O4S2 and a molecular weight of 330.82 g/mol. Its IUPAC name is 5-chloro-N-[2-(ethylsulfamoyl)ethyl]-1-methylimidazole-4-sulfonamide.
| Compound Name | 5-chloro-N-[2-(ethylsulfamoyl)ethyl]-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 113233818 |
| Molecular Formula | C8H15ClN4O4S2 |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 5-chloro-N-[2-(ethylsulfamoyl)ethyl]-1-methylimidazole-4-sulfonamide |
| SMILES | CCNS(=O)(=O)CCNS(=O)(=O)c1ncn(C)c1Cl |
| InChI | InChI=1S/C8H15ClN4O4S2/c1-3-11-18(14,15)5-4-12-19(16,17)8-7(9)13(2)6-10-8/h6,11-12H,3-5H2,1-2H3 |
| InChIKey | AHJRUURLVMISOW-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |