C10H18ClN3O3S — CID 103858809
5-chloro-N-(5-hydroxy-4-methylpentyl)-1-methylimidazole-4-sulfonamide (PubChem CID 103858809) has the molecular formula C10H18ClN3O3S and a molecular weight of 295.79 g/mol. Its IUPAC name is 5-chloro-N-(5-hydroxy-4-methylpentyl)-1-methylimidazole-4-sulfonamide.
| Compound Name | 5-chloro-N-(5-hydroxy-4-methylpentyl)-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 103858809 |
| Molecular Formula | C10H18ClN3O3S |
| Molecular Weight | 295.79 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 5-chloro-N-(5-hydroxy-4-methylpentyl)-1-methylimidazole-4-sulfonamide |
| SMILES | CC(CO)CCCNS(=O)(=O)c1ncn(C)c1Cl |
| InChI | InChI=1S/C10H18ClN3O3S/c1-8(6-15)4-3-5-13-18(16,17)10-9(11)14(2)7-12-10/h7-8,13,15H,3-6H2,1-2H3 |
| InChIKey | USAMGYNTDFUNEA-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.79 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|