C8H15ClN4O2S — CID 61250573
N-(4-aminobutyl)-5-chloro-1-methylimidazole-4-sulfonamide (PubChem CID 61250573) has the molecular formula C8H15ClN4O2S and a molecular weight of 266.75 g/mol. Its IUPAC name is N-(4-aminobutyl)-5-chloro-1-methylimidazole-4-sulfonamide.
| Compound Name | N-(4-aminobutyl)-5-chloro-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 61250573 |
| Molecular Formula | C8H15ClN4O2S |
| Molecular Weight | 266.75 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | N-(4-aminobutyl)-5-chloro-1-methylimidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)NCCCCN)c1Cl |
| InChI | InChI=1S/C8H15ClN4O2S/c1-13-6-11-8(7(13)9)16(14,15)12-5-3-2-4-10/h6,12H,2-5,10H2,1H3 |
| InChIKey | KRJFJZMYNZHYQP-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.75 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|