C7H13ClN4O2S — CID 61247762
N-(3-aminopropyl)-5-chloro-1-methylimidazole-4-sulfonamide (PubChem CID 61247762) has the molecular formula C7H13ClN4O2S and a molecular weight of 252.73 g/mol. Its IUPAC name is N-(3-aminopropyl)-5-chloro-1-methylimidazole-4-sulfonamide.
| Compound Name | N-(3-aminopropyl)-5-chloro-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 61247762 |
| Molecular Formula | C7H13ClN4O2S |
| Molecular Weight | 252.73 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | N-(3-aminopropyl)-5-chloro-1-methylimidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)NCCCN)c1Cl |
| InChI | InChI=1S/C7H13ClN4O2S/c1-12-5-10-7(6(12)8)15(13,14)11-4-2-3-9/h5,11H,2-4,9H2,1H3 |
| InChIKey | XMJCJDQQMHEHNQ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.73 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|