C8H11ClF3N3O2S — CID 79040358
5-chloro-1-methyl-N-(4,4,4-trifluorobutyl)imidazole-4-sulfonamide (PubChem CID 79040358) has the molecular formula C8H11ClF3N3O2S and a molecular weight of 305.71 g/mol. Its IUPAC name is 5-chloro-1-methyl-N-(4,4,4-trifluorobutyl)imidazole-4-sulfonamide.
| Compound Name | 5-chloro-1-methyl-N-(4,4,4-trifluorobutyl)imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 79040358 |
| Molecular Formula | C8H11ClF3N3O2S |
| Molecular Weight | 305.71 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 5-chloro-1-methyl-N-(4,4,4-trifluorobutyl)imidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)NCCCC(F)(F)F)c1Cl |
| InChI | InChI=1S/C8H11ClF3N3O2S/c1-15-5-13-7(6(15)9)18(16,17)14-4-2-3-8(10,11)12/h5,14H,2-4H2,1H3 |
| InChIKey | ZBENOJMVRBJHDT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.71 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|